C29H24ClN3O3 — CID 41066645
ethyl (1R,2S,3S,10bS)-3-[(4-chlorophenyl)carbamoyl]-1-cyano-2-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1-carboxylate (PubChem CID 41066645) has the molecular formula C29H24ClN3O3 and a molecular weight of 497.98 g/mol. Its IUPAC name is ethyl (1R,2S,3S,10bS)-3-[(4-chlorophenyl)carbamoyl]-1-cyano-2-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1-carboxylate.
| Compound Name | ethyl (1R,2S,3S,10bS)-3-[(4-chlorophenyl)carbamoyl]-1-cyano-2-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 41066645 |
| Molecular Formula | C29H24ClN3O3 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | ethyl (1R,2S,3S,10bS)-3-[(4-chlorophenyl)carbamoyl]-1-cyano-2-phenyl-3,10b-dihydro-2H-pyrrolo[2,1-a]isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C#N)[C@H](c2ccccc2)[C@@H](C(=O)Nc2ccc(Cl)cc2)N2C=Cc3ccccc3[C@H]21 |
| InChI | InChI=1S/C29H24ClN3O3/c1-2-36-28(35)29(18-31)24(20-9-4-3-5-10-20)25(27(34)32-22-14-12-21(30)13-15-22)33-17-16-19-8-6-7-11-23(19)26(29)33/h3-17,24-26H,2H2,1H3,(H,32,34)/t24-,25+,26+,29-/m1/s1 |
| InChIKey | YURSCSDTKJFHBX-DAMQTCOWSA-N |
| XLogP | 5.55 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |