C17H12N4O6S — CID 41066831
(E)-N-[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 41066831) has the molecular formula C17H12N4O6S and a molecular weight of 400.37 g/mol. Its IUPAC name is (E)-N-[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 41066831 |
| Molecular Formula | C17H12N4O6S |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | (E)-N-[5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazol-2-yl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])s1)Nc1nnc([C@@H]2COc3ccccc3O2)o1 |
| InChI | InChI=1S/C17H12N4O6S/c22-14(7-5-10-6-8-15(28-10)21(23)24)18-17-20-19-16(27-17)13-9-25-11-3-1-2-4-12(11)26-13/h1-8,13H,9H2,(H,18,20,22)/b7-5+/t13-/m0/s1 |
| InChIKey | FUABMEFEALFMPE-IYNGYCSASA-N |
| XLogP | 3.20 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|