C22H15N3O8 — CID 41066888
(5S)-1-(furan-2-ylmethyl)-4-[hydroxy-(3-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 41066888) has the molecular formula C22H15N3O8 and a molecular weight of 449.38 g/mol. Its IUPAC name is (5S)-1-(furan-2-ylmethyl)-4-[hydroxy-(3-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-(furan-2-ylmethyl)-4-[hydroxy-(3-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41066888 |
| Molecular Formula | C22H15N3O8 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | (5S)-1-(furan-2-ylmethyl)-4-[hydroxy-(3-nitrophenyl)methylidene]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccco2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H15N3O8/c26-20(14-5-2-7-16(11-14)25(31)32)18-19(13-4-1-6-15(10-13)24(29)30)23(22(28)21(18)27)12-17-8-3-9-33-17/h1-11,19,26H,12H2/t19-/m0/s1 |
| InChIKey | NTGWHGIXQGAVCG-IBGZPJMESA-N |
| XLogP | 3.72 |
| TPSA | 157.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|