C23H17BrN2O3 — CID 41066945
(3S,3aS,6aS)-5-(4-bromophenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 41066945) has the molecular formula C23H17BrN2O3 and a molecular weight of 449.30 g/mol. Its IUPAC name is (3S,3aS,6aS)-5-(4-bromophenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aS,6aS)-5-(4-bromophenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 41066945 |
| Molecular Formula | C23H17BrN2O3 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | (3S,3aS,6aS)-5-(4-bromophenyl)-2,3-diphenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2[C@H](ON(c3ccccc3)[C@@H]2c2ccccc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H17BrN2O3/c24-16-11-13-17(14-12-16)25-22(27)19-20(15-7-3-1-4-8-15)26(29-21(19)23(25)28)18-9-5-2-6-10-18/h1-14,19-21H/t19-,20+,21-/m0/s1 |
| InChIKey | YXEPNMZUECRAEI-HBMCJLEFSA-N |
| XLogP | 4.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|