C25H20N4O3 — CID 41067448
(9R)-13-(2-methoxyphenyl)-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one (PubChem CID 41067448) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is (9R)-13-(2-methoxyphenyl)-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one.
| Compound Name | (9R)-13-(2-methoxyphenyl)-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
|---|---|
| PubChem CID | 41067448 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (9R)-13-(2-methoxyphenyl)-9-phenyl-2-oxa-12,14,15,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),11,13,16-pentaen-7-one |
| SMILES | COc1ccccc1-c1nc2c3c(ncn2n1)OC1=C(C(=O)CCC1)[C@@H]3c1ccccc1 |
| InChI | InChI=1S/C25H20N4O3/c1-31-18-12-6-5-10-16(18)23-27-24-22-20(15-8-3-2-4-9-15)21-17(30)11-7-13-19(21)32-25(22)26-14-29(24)28-23/h2-6,8-10,12,14,20H,7,11,13H2,1H3/t20-/m0/s1 |
| InChIKey | CSYFNZORJONEHW-FQEVSTJZSA-N |
| XLogP | 4.33 |
| TPSA | 78.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |