C17H19N5O8S — CID 41067968
(6S,7R)-3-(acetyloxymethyl)-7-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 41067968) has the molecular formula C17H19N5O8S and a molecular weight of 453.43 g/mol. Its IUPAC name is (6S,7R)-3-(acetyloxymethyl)-7-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(acetyloxymethyl)-7-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 41067968 |
| Molecular Formula | C17H19N5O8S |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (6S,7R)-3-(acetyloxymethyl)-7-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)Cn3nc(C)c([N+](=O)[O-])c3C)[C@@H]2SC1 |
| InChI | InChI=1S/C17H19N5O8S/c1-7-13(22(28)29)8(2)20(19-7)4-11(24)18-12-15(25)21-14(17(26)27)10(5-30-9(3)23)6-31-16(12)21/h12,16H,4-6H2,1-3H3,(H,18,24)(H,26,27)/t12-,16+/m1/s1 |
| InChIKey | JSMGLSFRHRBDHH-WBMJQRKESA-N |
| XLogP | -0.29 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|