C25H18FN3O2S — CID 41068019
(5R,5'Z,10bS)-5'-[(4-fluorophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 41068019) has the molecular formula C25H18FN3O2S and a molecular weight of 443.50 g/mol. Its IUPAC name is (5R,5'Z,10bS)-5'-[(4-fluorophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5R,5'Z,10bS)-5'-[(4-fluorophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 41068019 |
| Molecular Formula | C25H18FN3O2S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (5R,5'Z,10bS)-5'-[(4-fluorophenyl)methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1N[C@]2(Oc3ccccc3[C@@H]3CC(c4ccccc4)=NN32)/C(=C/c2ccc(F)cc2)S1 |
| InChI | InChI=1S/C25H18FN3O2S/c26-18-12-10-16(11-13-18)14-23-25(27-24(30)32-23)29-21(19-8-4-5-9-22(19)31-25)15-20(28-29)17-6-2-1-3-7-17/h1-14,21H,15H2,(H,27,30)/b23-14-/t21-,25+/m0/s1 |
| InChIKey | PYVPNZPPRXQWOV-VYGFSGDLSA-N |
| XLogP | 5.52 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|