C17H18N6O3S2 — CID 4107072
N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 4107072) has the molecular formula C17H18N6O3S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4107072 |
| Molecular Formula | C17H18N6O3S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CSc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C17H18N6O3S2/c1-22(2)28(25,26)15-10-6-7-13(11-15)18-16(24)12-27-17-19-20-21-23(17)14-8-4-3-5-9-14/h3-11H,12H2,1-2H3,(H,18,24) |
| InChIKey | APTNHOIWKIMVJU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |