C26H28N4O4S3 — CID 4107125
2-N,5-N-bis(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)thiophene-2,5-dicarboxamide (PubChem CID 4107125) has the molecular formula C26H28N4O4S3 and a molecular weight of 556.74 g/mol. Its IUPAC name is 2-N,5-N-bis(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4107125 |
| Molecular Formula | C26H28N4O4S3 |
| Molecular Weight | 556.74 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-N,5-N-bis(3-carbamoyl-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)thiophene-2,5-dicarboxamide |
| SMILES | CC1CCc2c(sc(NC(=O)c3ccc(C(=O)Nc4sc5c(c4C(N)=O)CCC(C)C5)s3)c2C(N)=O)C1 |
| InChI | InChI=1S/C26H28N4O4S3/c1-11-3-5-13-17(9-11)36-25(19(13)21(27)31)29-23(33)15-7-8-16(35-15)24(34)30-26-20(22(28)32)14-6-4-12(2)10-18(14)37-26/h7-8,11-12H,3-6,9-10H2,1-2H3,(H2,27,31)(H2,28,32)(H,29,33)(H,30,34) |
| InChIKey | XHBQZDSCXIBEDD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |