C17H21F3N2O2 — CID 41074693
2-(2-oxoazepan-1-yl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 41074693) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-(2-oxoazepan-1-yl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | 2-(2-oxoazepan-1-yl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 41074693 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(2-oxoazepan-1-yl)-N-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1CCCCCC1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-12(13-6-5-7-14(10-13)17(18,19)20)21-15(23)11-22-9-4-2-3-8-16(22)24/h5-7,10,12H,2-4,8-9,11H2,1H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | KJHSFGHGULBNNC-LBPRGKRZSA-N |
| XLogP | 3.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |