C23H21F2N3O2 — CID 41074865
N-(4-fluorophenyl)-2-[[2-[[(1S)-1-(3-fluorophenyl)ethyl]amino]acetyl]amino]benzamide (PubChem CID 41074865) has the molecular formula C23H21F2N3O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[2-[[(1S)-1-(3-fluorophenyl)ethyl]amino]acetyl]amino]benzamide.
| Compound Name | N-(4-fluorophenyl)-2-[[2-[[(1S)-1-(3-fluorophenyl)ethyl]amino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 41074865 |
| Molecular Formula | C23H21F2N3O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[2-[[(1S)-1-(3-fluorophenyl)ethyl]amino]acetyl]amino]benzamide |
| SMILES | C[C@H](NCC(=O)Nc1ccccc1C(=O)Nc1ccc(F)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H21F2N3O2/c1-15(16-5-4-6-18(25)13-16)26-14-22(29)28-21-8-3-2-7-20(21)23(30)27-19-11-9-17(24)10-12-19/h2-13,15,26H,14H2,1H3,(H,27,30)(H,28,29)/t15-/m0/s1 |
| InChIKey | DRHVUOJEIXVYCD-HNNXBMFYSA-N |
| XLogP | 4.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |