C24H20N2O6 — CID 41075065
ethyl (3S)-2'-amino-1,5-dimethyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate (PubChem CID 41075065) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is ethyl (3S)-2'-amino-1,5-dimethyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate.
| Compound Name | ethyl (3S)-2'-amino-1,5-dimethyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate |
|---|---|
| PubChem CID | 41075065 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | ethyl (3S)-2'-amino-1,5-dimethyl-2,5'-dioxospiro[indole-3,4'-pyrano[3,2-c]chromene]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Oc2c(c(=O)oc3ccccc23)[C@]12C(=O)N(C)c1ccc(C)cc12 |
| InChI | InChI=1S/C24H20N2O6/c1-4-30-21(27)18-20(25)32-19-13-7-5-6-8-16(13)31-22(28)17(19)24(18)14-11-12(2)9-10-15(14)26(3)23(24)29/h5-11H,4,25H2,1-3H3/t24-/m0/s1 |
| InChIKey | CXGMZCMEADJRMJ-DEOSSOPVSA-N |
| XLogP | 2.49 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|