C22H24N2O4 — CID 41075657
(3S)-2-[4-(4-acetylphenoxy)butanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 41075657) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (3S)-2-[4-(4-acetylphenoxy)butanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[4-(4-acetylphenoxy)butanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 41075657 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (3S)-2-[4-(4-acetylphenoxy)butanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)N2Cc3ccccc3C[C@H]2C(N)=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-15(25)16-8-10-19(11-9-16)28-12-4-7-21(26)24-14-18-6-3-2-5-17(18)13-20(24)22(23)27/h2-3,5-6,8-11,20H,4,7,12-14H2,1H3,(H2,23,27)/t20-/m0/s1 |
| InChIKey | KJXYBORUXXBNLB-FQEVSTJZSA-N |
| XLogP | 2.49 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|