C31H31NO6 — CID 41078684
(5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 41078684) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is (5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41078684 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | (5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1cccc([C@@H]2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2Cc2ccccc2)c1 |
| InChI | InChI=1S/C31H31NO6/c1-2-3-7-15-36-24-12-8-11-22(18-24)28-27(29(33)23-13-14-25-26(19-23)38-17-16-37-25)30(34)31(35)32(28)20-21-9-5-4-6-10-21/h4-6,8-14,18-19,28,33H,2-3,7,15-17,20H2,1H3/t28-/m1/s1 |
| InChIKey | JWVVPSZPLSDITF-MUUNZHRXSA-N |
| XLogP | 5.65 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|