C23H21BrN4O3S — CID 4107871
6-[[3-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4107871) has the molecular formula C23H21BrN4O3S and a molecular weight of 513.42 g/mol. Its IUPAC name is 6-[[3-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[3-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4107871 |
| Molecular Formula | C23H21BrN4O3S |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 6-[[3-[2-(4-bromophenoxy)ethoxy]phenyl]methylidene]-5-imino-2-propyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cccc(OCCOc3ccc(Br)cc3)c2)C(=O)N=C2SC(CCC)=NN21 |
| InChI | InChI=1S/C23H21BrN4O3S/c1-2-4-20-27-28-21(25)19(22(29)26-23(28)32-20)14-15-5-3-6-18(13-15)31-12-11-30-17-9-7-16(24)8-10-17/h3,5-10,13-14,25H,2,4,11-12H2,1H3/b19-14?,25-21+ |
| InChIKey | UJEYEPRUENESGY-QCIJEGJASA-N |
| XLogP | 5.33 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|