C30H31NO6 — CID 41081544
(5S)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 41081544) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is (5S)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41081544 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (5S)-1-(furan-2-ylmethyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1cccc([C@H]2C(=C(O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2Cc2ccco2)c1 |
| InChI | InChI=1S/C30H31NO6/c1-3-4-5-13-35-23-9-6-8-20(17-23)27-26(29(33)30(34)31(27)18-24-10-7-14-36-24)28(32)21-11-12-25-22(16-21)15-19(2)37-25/h6-12,14,16-17,19,27,32H,3-5,13,15,18H2,1-2H3/t19-,27-/m0/s1 |
| InChIKey | AMNFSNAOCTYPLR-PPHZAIPVSA-N |
| XLogP | 5.79 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|