C25H24FN3O4S — CID 41082310
(3S)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 41082310) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is (3S)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41082310 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | (3S)-N-[2-[(5Z)-5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCN1C(=O)S/C(=C\c2ccc(F)cc2)C1=O)[C@H]1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C25H24FN3O4S/c26-20-8-6-18(7-9-20)14-21-24(32)29(25(33)34-21)13-11-27-23(31)19-15-22(30)28(16-19)12-10-17-4-2-1-3-5-17/h1-9,14,19H,10-13,15-16H2,(H,27,31)/b21-14-/t19-/m0/s1 |
| InChIKey | GDZRLHBMJAMKBU-BJLUOBIUSA-N |
| XLogP | 3.07 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|