C14H14ClN3O — CID 41083408
1-(3-chlorophenyl)-3-[(1R)-1-pyridin-2-ylethyl]urea (PubChem CID 41083408) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(1R)-1-pyridin-2-ylethyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(1R)-1-pyridin-2-ylethyl]urea |
|---|---|
| PubChem CID | 41083408 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(1R)-1-pyridin-2-ylethyl]urea |
| SMILES | C[C@@H](NC(=O)Nc1cccc(Cl)c1)c1ccccn1 |
| InChI | InChI=1S/C14H14ClN3O/c1-10(13-7-2-3-8-16-13)17-14(19)18-12-6-4-5-11(15)9-12/h2-10H,1H3,(H2,17,18,19)/t10-/m1/s1 |
| InChIKey | MXPLYRQVKFHXDV-SNVBAGLBSA-N |
| XLogP | 3.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |