About 3-cyclohexyl-N,N-dimethylpropanamide
3-cyclohexyl-N,N-dimethylpropanamide (PubChem CID 4108486) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-cyclohexyl-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-cyclohexyl-N,N-dimethylpropanamide |
| PubChem CID | 4108486 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-cyclohexyl-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C11H21NO/c1-12(2)11(13)9-8-10-6-4-3-5-7-10/h10H,3-9H2,1-2H3 |
| InChIKey | GFWAWQIDTXAJPS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-N,N-dimethylpropanamide?
The IUPAC name of 3-cyclohexyl-N,N-dimethylpropanamide (CID 4108486) is 3-cyclohexyl-N,N-dimethylpropanamide.
What is the SMILES notation for 3-cyclohexyl-N,N-dimethylpropanamide?
The canonical SMILES for 3-cyclohexyl-N,N-dimethylpropanamide is CN(C)C(=O)CCC1CCCCC1.
What is the InChIKey of 3-cyclohexyl-N,N-dimethylpropanamide?
The InChIKey is GFWAWQIDTXAJPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-12(2)11(13)9-8-10-6-4-3-5-7-10/h10H,3-9H2,1-2H3.
What are the key properties of 3-cyclohexyl-N,N-dimethylpropanamide?
3-cyclohexyl-N,N-dimethylpropanamide has a molecular weight of 183.29 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-N,N-dimethylpropanamide is sourced from PubChem (CID 4108486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).