C15H20F3N3O3 — CID 4108499
methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate (PubChem CID 4108499) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 4108499 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(3-methylbutanoylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(NC(=O)CC(C)C)(Nc1ncccc1C)C(F)(F)F |
| InChI | InChI=1S/C15H20F3N3O3/c1-9(2)8-11(22)20-14(13(23)24-4,15(16,17)18)21-12-10(3)6-5-7-19-12/h5-7,9H,8H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | ICFWPPSHUHEEKZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|