C25H33N3O2S2 — CID 41085763
N-[3-(dimethylamino)propyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide (PubChem CID 41085763) has the molecular formula C25H33N3O2S2 and a molecular weight of 471.69 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41085763 |
| Molecular Formula | C25H33N3O2S2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)-4-(4-methoxyphenyl)sulfanylbutanamide |
| SMILES | COc1ccc(SCCCC(=O)N(CCCN(C)C)c2nc3cc(C)c(C)cc3s2)cc1 |
| InChI | InChI=1S/C25H33N3O2S2/c1-18-16-22-23(17-19(18)2)32-25(26-22)28(14-7-13-27(3)4)24(29)8-6-15-31-21-11-9-20(30-5)10-12-21/h9-12,16-17H,6-8,13-15H2,1-5H3 |
| InChIKey | TZLPOADGKPUAAC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|