C22H25F2N3OS2 — CID 41086759
N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide (PubChem CID 41086759) has the molecular formula C22H25F2N3OS2 and a molecular weight of 449.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide |
|---|---|
| PubChem CID | 41086759 |
| Molecular Formula | C22H25F2N3OS2 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-(6-fluoro-1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)sulfanylbutanamide |
| SMILES | CN(C)CCCN(C(=O)CCCSc1ccc(F)cc1)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C22H25F2N3OS2/c1-26(2)12-4-13-27(22-25-19-11-8-17(24)15-20(19)30-22)21(28)5-3-14-29-18-9-6-16(23)7-10-18/h6-11,15H,3-5,12-14H2,1-2H3 |
| InChIKey | FCWFUVUSHDFKPD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|