About N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide
N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide (PubChem CID 4108775) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide.
Molecular Properties
| Compound Name | N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide |
| PubChem CID | 4108775 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide |
| SMILES | COC1(NC(=O)c2ccccc2)C(C)=CC(=O)C=C1C |
| InChI | InChI=1S/C16H17NO3/c1-11-9-14(18)10-12(2)16(11,20-3)17-15(19)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,17,19) |
| InChIKey | UNAHYOFZPLPNBB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide?
The IUPAC name of N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide (CID 4108775) is N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide.
What is the SMILES notation for N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide?
The canonical SMILES for N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide is COC1(NC(=O)c2ccccc2)C(C)=CC(=O)C=C1C.
What is the InChIKey of N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide?
The InChIKey is UNAHYOFZPLPNBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-11-9-14(18)10-12(2)16(11,20-3)17-15(19)13-7-5-4-6-8-13/h4-10H,1-3H3,(H,17,19).
What are the key properties of N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide?
N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide has a molecular weight of 271.32 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methoxy-2,6-dimethyl-4-oxocyclohexa-2,5-dien-1-yl)benzamide is sourced from PubChem (CID 4108775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).