C9H14N2O4S2 — CID 41091357
N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide (PubChem CID 41091357) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide.
| Compound Name | N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide |
|---|---|
| PubChem CID | 41091357 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | N-[(3aS,6aR)-3-methyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-methoxyacetamide |
| SMILES | COCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1C |
| InChI | InChI=1S/C9H14N2O4S2/c1-11-6-4-17(13,14)5-7(6)16-9(11)10-8(12)3-15-2/h6-7H,3-5H2,1-2H3/b10-9-/t6-,7-/m0/s1 |
| InChIKey | GHCPUGNBYKOJMI-ZUQJNVCHSA-N |
| XLogP | -0.64 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|