C24H23N3O7S — CID 41092444
ethyl 2-[2-[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate (PubChem CID 41092444) has the molecular formula C24H23N3O7S and a molecular weight of 497.53 g/mol. Its IUPAC name is ethyl 2-[2-[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41092444 |
| Molecular Formula | C24H23N3O7S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | ethyl 2-[2-[3-(2,5-dioxopyrrolidin-1-yl)benzoyl]imino-5,6-dimethoxy-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cccc(N3C(=O)CCC3=O)c2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C24H23N3O7S/c1-4-34-22(30)13-26-16-11-17(32-2)18(33-3)12-19(16)35-24(26)25-23(31)14-6-5-7-15(10-14)27-20(28)8-9-21(27)29/h5-7,10-12H,4,8-9,13H2,1-3H3/b25-24- |
| InChIKey | KZLCEDXRFKKMOL-IZHYLOQSSA-N |
| XLogP | 2.68 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|