C20H28N4O3S2 — CID 41094019
[2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 41094019) has the molecular formula C20H28N4O3S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 41094019 |
| Molecular Formula | C20H28N4O3S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [2-[[(1R,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CCn1c(SCC(=O)OCC(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)nnc1-c1cccs1 |
| InChI | InChI=1S/C20H28N4O3S2/c1-4-24-19(16-9-6-10-28-16)22-23-20(24)29-12-18(26)27-11-17(25)21-15-8-5-7-13(2)14(15)3/h6,9-10,13-15H,4-5,7-8,11-12H2,1-3H3,(H,21,25)/t13-,14+,15-/m1/s1 |
| InChIKey | DUQGFRYWLPMVSF-QLFBSQMISA-N |
| XLogP | 3.60 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |