C23H21N5O — CID 41096542
(2R)-N-benzhydryl-3-phenyl-2-(tetrazol-1-yl)propanamide (PubChem CID 41096542) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is (2R)-N-benzhydryl-3-phenyl-2-(tetrazol-1-yl)propanamide.
| Compound Name | (2R)-N-benzhydryl-3-phenyl-2-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 41096542 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (2R)-N-benzhydryl-3-phenyl-2-(tetrazol-1-yl)propanamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)[C@@H](Cc1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C23H21N5O/c29-23(21(28-17-24-26-27-28)16-18-10-4-1-5-11-18)25-22(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17,21-22H,16H2,(H,25,29)/t21-/m1/s1 |
| InChIKey | WONTVXWQQTXVCK-OAQYLSRUSA-N |
| XLogP | 3.36 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |