C9H17NO2S — CID 41097231
S-methyl N-[(1R,2S)-2-methoxycyclohexyl]carbamothioate (PubChem CID 41097231) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is S-methyl N-[(1R,2S)-2-methoxycyclohexyl]carbamothioate.
| Compound Name | S-methyl N-[(1R,2S)-2-methoxycyclohexyl]carbamothioate |
|---|---|
| PubChem CID | 41097231 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | S-methyl N-[(1R,2S)-2-methoxycyclohexyl]carbamothioate |
| SMILES | CO[C@H]1CCCC[C@H]1NC(=O)SC |
| InChI | InChI=1S/C9H17NO2S/c1-12-8-6-4-3-5-7(8)10-9(11)13-2/h7-8H,3-6H2,1-2H3,(H,10,11)/t7-,8+/m1/s1 |
| InChIKey | IOTMQUJRLGPJRI-SFYZADRCSA-N |
| XLogP | 2.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|