About 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate
3-cyano-1,4-dimethyl-6-oxopyridin-2-olate (PubChem CID 41097286) has the molecular formula C8H7N2O2-
and a molecular weight of 163.16 g/mol. Its IUPAC name is 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate.
Molecular Properties
| Compound Name | 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate |
| PubChem CID | 41097286 |
| Molecular Formula | C8H7N2O2- |
| Molecular Weight | 163.16 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate |
| SMILES | Cc1cc(=O)n(C)c([O-])c1C#N |
| InChI | InChI=1S/C8H8N2O2/c1-5-3-7(11)10(2)8(12)6(5)4-9/h3,12H,1-2H3/p-1 |
| InChIKey | PJKGLFXXEKCAIE-UHFFFAOYSA-M |
| XLogP | -0.36 |
| TPSA | 68.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate?
The IUPAC name of 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate (CID 41097286) is 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate.
What is the SMILES notation for 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate?
The canonical SMILES for 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate is Cc1cc(=O)n(C)c([O-])c1C#N.
What is the InChIKey of 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate?
The InChIKey is PJKGLFXXEKCAIE-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8N2O2/c1-5-3-7(11)10(2)8(12)6(5)4-9/h3,12H,1-2H3/p-1.
What are the key properties of 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate?
3-cyano-1,4-dimethyl-6-oxopyridin-2-olate has a molecular weight of 163.16 g/mol, XLogP of -0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-1,4-dimethyl-6-oxopyridin-2-olate is sourced from PubChem (CID 41097286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).