About N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide
N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide (PubChem CID 41097391) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide.
Molecular Properties
| Compound Name | N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide |
| PubChem CID | 41097391 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide |
| SMILES | CC(=O)N[C@H]1c2ccccc2C(C)(C)C12CCC(=O)CC2 |
| InChI | InChI=1S/C18H23NO2/c1-12(20)19-16-14-6-4-5-7-15(14)17(2,3)18(16)10-8-13(21)9-11-18/h4-7,16H,8-11H2,1-3H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | CKJWZBKXUUYESW-INIZCTEOSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide?
The IUPAC name of N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide (CID 41097391) is N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide.
What is the SMILES notation for N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide?
The canonical SMILES for N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide is CC(=O)N[C@H]1c2ccccc2C(C)(C)C12CCC(=O)CC2.
What is the InChIKey of N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide?
The InChIKey is CKJWZBKXUUYESW-INIZCTEOSA-N. The full InChI is InChI=1S/C18H23NO2/c1-12(20)19-16-14-6-4-5-7-15(14)17(2,3)18(16)10-8-13(21)9-11-18/h4-7,16H,8-11H2,1-3H3,(H,19,20)/t16-/m0/s1.
What are the key properties of N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide?
N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide has a molecular weight of 285.39 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-3,3-dimethyl-4'-oxospiro[1H-indene-2,1'-cyclohexane]-1-yl]acetamide is sourced from PubChem (CID 41097391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).