About (2R)-2-methylbutanamide
(2R)-2-methylbutanamide (PubChem CID 41097729) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is (2R)-2-methylbutanamide.
Molecular Properties
| Compound Name | (2R)-2-methylbutanamide |
| PubChem CID | 41097729 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | (2R)-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(N)=O |
| InChI | InChI=1S/C5H11NO/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H2,6,7)/t4-/m1/s1 |
| InChIKey | XUXJHBAJZQREDB-SCSAIBSYSA-N |
| XLogP | 0.52 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methylbutanamide?
The IUPAC name of (2R)-2-methylbutanamide (CID 41097729) is (2R)-2-methylbutanamide.
What is the SMILES notation for (2R)-2-methylbutanamide?
The canonical SMILES for (2R)-2-methylbutanamide is CC[C@@H](C)C(N)=O.
What is the InChIKey of (2R)-2-methylbutanamide?
The InChIKey is XUXJHBAJZQREDB-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H11NO/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H2,6,7)/t4-/m1/s1.
What are the key properties of (2R)-2-methylbutanamide?
(2R)-2-methylbutanamide has a molecular weight of 101.15 g/mol, XLogP of 0.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methylbutanamide is sourced from PubChem (CID 41097729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).