C16H20ClNO2S — CID 41099275
2-chloro-6-methoxy-4-[[[(1S)-2-methyl-1-thiophen-2-ylpropyl]amino]methyl]phenol (PubChem CID 41099275) has the molecular formula C16H20ClNO2S and a molecular weight of 325.86 g/mol. Its IUPAC name is 2-chloro-6-methoxy-4-[[[(1S)-2-methyl-1-thiophen-2-ylpropyl]amino]methyl]phenol.
| Compound Name | 2-chloro-6-methoxy-4-[[[(1S)-2-methyl-1-thiophen-2-ylpropyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 41099275 |
| Molecular Formula | C16H20ClNO2S |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-chloro-6-methoxy-4-[[[(1S)-2-methyl-1-thiophen-2-ylpropyl]amino]methyl]phenol |
| SMILES | COc1cc(CN[C@H](c2cccs2)C(C)C)cc(Cl)c1O |
| InChI | InChI=1S/C16H20ClNO2S/c1-10(2)15(14-5-4-6-21-14)18-9-11-7-12(17)16(19)13(8-11)20-3/h4-8,10,15,18-19H,9H2,1-3H3/t15-/m0/s1 |
| InChIKey | VEROLWJPZVKINI-HNNXBMFYSA-N |
| XLogP | 4.60 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |