About N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide
N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide (PubChem CID 4110016) has the molecular formula C18H10F2N2OS
and a molecular weight of 340.35 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide |
| PubChem CID | 4110016 |
| Molecular Formula | C18H10F2N2OS |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide |
| SMILES | O=C(Nc1nc2ccc3ccccc3c2s1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H10F2N2OS/c19-12-6-3-7-13(20)15(12)17(23)22-18-21-14-9-8-10-4-1-2-5-11(10)16(14)24-18/h1-9H,(H,21,22,23) |
| InChIKey | LQVVFOGICZXLMG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide?
The IUPAC name of N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide (CID 4110016) is N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide.
What is the SMILES notation for N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide?
The canonical SMILES for N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide is O=C(Nc1nc2ccc3ccccc3c2s1)c1c(F)cccc1F.
What is the InChIKey of N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide?
The InChIKey is LQVVFOGICZXLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F2N2OS/c19-12-6-3-7-13(20)15(12)17(23)22-18-21-14-9-8-10-4-1-2-5-11(10)16(14)24-18/h1-9H,(H,21,22,23).
What are the key properties of N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide?
N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide has a molecular weight of 340.35 g/mol, XLogP of 4.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzo[g][1,3]benzothiazol-2-yl-2,6-difluorobenzamide is sourced from PubChem (CID 4110016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).