C28H24N2O5 — CID 41101102
(5S)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 41101102) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is (5S)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41101102 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (5S)-4-[hydroxy(naphthalen-2-yl)methylidene]-1-(5-methyl-1,2-oxazol-3-yl)-5-(4-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc([C@H]2C(=C(O)c3ccc4ccccc4c3)C(=O)C(=O)N2c2cc(C)on2)cc1 |
| InChI | InChI=1S/C28H24N2O5/c1-3-14-34-22-12-10-19(11-13-22)25-24(27(32)28(33)30(25)23-15-17(2)35-29-23)26(31)21-9-8-18-6-4-5-7-20(18)16-21/h4-13,15-16,25,31H,3,14H2,1-2H3/t25-/m0/s1 |
| InChIKey | KPWNVBQKCNZPAV-VWLOTQADSA-N |
| XLogP | 5.55 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|