About 3-ethyl-1,1-bis(prop-2-enyl)thiourea
3-ethyl-1,1-bis(prop-2-enyl)thiourea (PubChem CID 4110144) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 3-ethyl-1,1-bis(prop-2-enyl)thiourea.
Molecular Properties
| Compound Name | 3-ethyl-1,1-bis(prop-2-enyl)thiourea |
| PubChem CID | 4110144 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-ethyl-1,1-bis(prop-2-enyl)thiourea |
| SMILES | C=CCN(CC=C)C(=S)NCC |
| InChI | InChI=1S/C9H16N2S/c1-4-7-11(8-5-2)9(12)10-6-3/h4-5H,1-2,6-8H2,3H3,(H,10,12) |
| InChIKey | FMXYKQUMDTZEMU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,1-bis(prop-2-enyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,1-bis(prop-2-enyl)thiourea?
The IUPAC name of 3-ethyl-1,1-bis(prop-2-enyl)thiourea (CID 4110144) is 3-ethyl-1,1-bis(prop-2-enyl)thiourea.
What is the SMILES notation for 3-ethyl-1,1-bis(prop-2-enyl)thiourea?
The canonical SMILES for 3-ethyl-1,1-bis(prop-2-enyl)thiourea is C=CCN(CC=C)C(=S)NCC.
What is the InChIKey of 3-ethyl-1,1-bis(prop-2-enyl)thiourea?
The InChIKey is FMXYKQUMDTZEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-4-7-11(8-5-2)9(12)10-6-3/h4-5H,1-2,6-8H2,3H3,(H,10,12).
What are the key properties of 3-ethyl-1,1-bis(prop-2-enyl)thiourea?
3-ethyl-1,1-bis(prop-2-enyl)thiourea has a molecular weight of 184.31 g/mol, XLogP of 1.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,1-bis(prop-2-enyl)thiourea is sourced from PubChem (CID 4110144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).