C21H25N7O2S — CID 41105243
N-[3-cyano-4,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide (PubChem CID 41105243) has the molecular formula C21H25N7O2S and a molecular weight of 439.55 g/mol. Its IUPAC name is N-[3-cyano-4,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide.
| Compound Name | N-[3-cyano-4,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 41105243 |
| Molecular Formula | C21H25N7O2S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[3-cyano-4,5-dimethyl-1-[[(2R)-oxolan-2-yl]methyl]pyrrol-2-yl]-2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)n2c(SCC(=O)Nc3c(C#N)c(C)c(C)n3C[C@H]3CCCO3)nnc2n1 |
| InChI | InChI=1S/C21H25N7O2S/c1-12-8-13(2)28-20(23-12)25-26-21(28)31-11-18(29)24-19-17(9-22)14(3)15(4)27(19)10-16-6-5-7-30-16/h8,16H,5-7,10-11H2,1-4H3,(H,24,29)/t16-/m1/s1 |
| InChIKey | GUIXRQBDOLCMGX-MRXNPFEDSA-N |
| XLogP | 2.94 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |