C20H22Cl2N4O3S — CID 41105841
ethyl (3S)-1-[(S)-(3,4-dichlorophenyl)-(6-hydroxy-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)methyl]piperidine-3-carboxylate (PubChem CID 41105841) has the molecular formula C20H22Cl2N4O3S and a molecular weight of 469.39 g/mol. Its IUPAC name is ethyl (3S)-1-[(S)-(3,4-dichlorophenyl)-(6-hydroxy-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[(S)-(3,4-dichlorophenyl)-(6-hydroxy-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 41105841 |
| Molecular Formula | C20H22Cl2N4O3S |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | ethyl (3S)-1-[(S)-(3,4-dichlorophenyl)-(6-hydroxy-2-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN([C@@H](c2ccc(Cl)c(Cl)c2)c2sc3nc(C)nn3c2O)C1 |
| InChI | InChI=1S/C20H22Cl2N4O3S/c1-3-29-19(28)13-5-4-8-25(10-13)16(12-6-7-14(21)15(22)9-12)17-18(27)26-20(30-17)23-11(2)24-26/h6-7,9,13,16,27H,3-5,8,10H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | LAKJKZSIPCJVKY-BBRMVZONSA-N |
| XLogP | 4.48 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |