C20H18N2O3S — CID 41107572
2-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 41107572) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 41107572 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)Cc3ccc4c(c3)OCO4)n2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c1-2-13-3-6-15(7-4-13)16-11-26-20(21-16)22-19(23)10-14-5-8-17-18(9-14)25-12-24-17/h3-9,11H,2,10,12H2,1H3,(H,21,22,23) |
| InChIKey | DXQXVYAAZLMKCT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |