C22H16Cl2N2O2S — CID 41109508
N-(1,3-benzothiazol-2-yl)-N-benzyl-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 41109508) has the molecular formula C22H16Cl2N2O2S and a molecular weight of 443.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-benzyl-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 41109508 |
| Molecular Formula | C22H16Cl2N2O2S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N(Cc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H16Cl2N2O2S/c23-16-10-11-19(17(24)12-16)28-14-21(27)26(13-15-6-2-1-3-7-15)22-25-18-8-4-5-9-20(18)29-22/h1-12H,13-14H2 |
| InChIKey | BPUDHZIFAYWZHZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |