C28H30N2O4S — CID 41109631
N-benzyl-3,4,5-triethoxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41109631) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-benzyl-3,4,5-triethoxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-3,4,5-triethoxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41109631 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-benzyl-3,4,5-triethoxy-N-(4-methyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1cc(C(=O)N(Cc2ccccc2)c2nc3c(C)cccc3s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C28H30N2O4S/c1-5-32-22-16-21(17-23(33-6-2)26(22)34-7-3)27(31)30(18-20-13-9-8-10-14-20)28-29-25-19(4)12-11-15-24(25)35-28/h8-17H,5-7,18H2,1-4H3 |
| InChIKey | MMDZCTIFKAOGIN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |