C24H22N2O2S — CID 41110246
N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide (PubChem CID 41110246) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide.
| Compound Name | N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 41110246 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-2,4-dimethylbenzamide |
| SMILES | COc1ccc2nc(N(Cc3ccccc3)C(=O)c3ccc(C)cc3C)sc2c1 |
| InChI | InChI=1S/C24H22N2O2S/c1-16-9-11-20(17(2)13-16)23(27)26(15-18-7-5-4-6-8-18)24-25-21-12-10-19(28-3)14-22(21)29-24/h4-14H,15H2,1-3H3 |
| InChIKey | KPXVKYZTEULZDC-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |