C19H15ClF3N5O2S — CID 41113106
(4S)-5-[2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one (PubChem CID 41113106) has the molecular formula C19H15ClF3N5O2S and a molecular weight of 469.88 g/mol. Its IUPAC name is (4S)-5-[2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one.
| Compound Name | (4S)-5-[2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 41113106 |
| Molecular Formula | C19H15ClF3N5O2S |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | (4S)-5-[2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetyl]-4-methyl-3,4-dihydro-1H-1,5-benzodiazepin-2-one |
| SMILES | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nnc2c(Cl)cc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C19H15ClF3N5O2S/c1-10-6-15(29)24-13-4-2-3-5-14(13)28(10)16(30)9-31-18-26-25-17-12(20)7-11(8-27(17)18)19(21,22)23/h2-5,7-8,10H,6,9H2,1H3,(H,24,29)/t10-/m0/s1 |
| InChIKey | JWYOWOZSLQALTK-JTQLQIEISA-N |
| XLogP | 4.26 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |