About [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate (PubChem CID 41113795) has the molecular formula C16H21N3O3S
and a molecular weight of 335.43 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate |
| PubChem CID | 41113795 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)c1cc(-c2csc(C)n2)c[nH]1 |
| InChI | InChI=1S/C16H21N3O3S/c1-4-5-10(2)18-15(20)8-22-16(21)13-6-12(7-17-13)14-9-23-11(3)19-14/h6-7,9-10,17H,4-5,8H2,1-3H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | IVJGYYJULGWDMH-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate?
The IUPAC name of [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate (CID 41113795) is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate.
What is the SMILES notation for [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate?
The canonical SMILES for [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate is CCC[C@@H](C)NC(=O)COC(=O)c1cc(-c2csc(C)n2)c[nH]1.
What is the InChIKey of [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate?
The InChIKey is IVJGYYJULGWDMH-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H21N3O3S/c1-4-5-10(2)18-15(20)8-22-16(21)13-6-12(7-17-13)14-9-23-11(3)19-14/h6-7,9-10,17H,4-5,8H2,1-3H3,(H,18,20)/t10-/m1/s1.
What are the key properties of [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate?
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate has a molecular weight of 335.43 g/mol, XLogP of 2.91, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 4-(2-methyl-1,3-thiazol-4-yl)-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 41113795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).