C23H23F3N2O4S — CID 41114901
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]sulfanylbenzoate (PubChem CID 41114901) has the molecular formula C23H23F3N2O4S and a molecular weight of 480.51 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]sulfanylbenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 41114901 |
| Molecular Formula | C23H23F3N2O4S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl]sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1SCC(=O)N[C@@H]1CCCc2ccccc21)NCC(F)(F)F |
| InChI | InChI=1S/C23H23F3N2O4S/c24-23(25,26)14-27-20(29)12-32-22(31)17-9-3-4-11-19(17)33-13-21(30)28-18-10-5-7-15-6-1-2-8-16(15)18/h1-4,6,8-9,11,18H,5,7,10,12-14H2,(H,27,29)(H,28,30)/t18-/m1/s1 |
| InChIKey | ZYQYQXZJCNCUDS-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |