C9H18NO+ — CID 4111740
2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol (PubChem CID 4111740) has the molecular formula C9H18NO+ and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol.
| Compound Name | 2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
|---|---|
| PubChem CID | 4111740 |
| Molecular Formula | C9H18NO+ |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 2,3,4,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ium-4a-ol |
| SMILES | OC12CCCCC1C[NH2+]CC2 |
| InChI | InChI=1S/C9H17NO/c11-9-4-2-1-3-8(9)7-10-6-5-9/h8,10-11H,1-7H2/p+1 |
| InChIKey | JCCPJOSXNCXEPE-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |