C16H24N2O3 — CID 41118317
methyl (2S,3R)-2-[[ethyl(phenyl)carbamoyl]amino]-3-methylpentanoate (PubChem CID 41118317) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (2S,3R)-2-[[ethyl(phenyl)carbamoyl]amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3R)-2-[[ethyl(phenyl)carbamoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 41118317 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl (2S,3R)-2-[[ethyl(phenyl)carbamoyl]amino]-3-methylpentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)N(CC)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C16H24N2O3/c1-5-12(3)14(15(19)21-4)17-16(20)18(6-2)13-10-8-7-9-11-13/h7-12,14H,5-6H2,1-4H3,(H,17,20)/t12-,14+/m1/s1 |
| InChIKey | IDUBCQYUIBGNHP-OCCSQVGLSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |