C20H15ClN2O3S — CID 41118424
(3S)-5-chloro-3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(thiophen-2-ylmethyl)indol-2-one (PubChem CID 41118424) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is (3S)-5-chloro-3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(thiophen-2-ylmethyl)indol-2-one.
| Compound Name | (3S)-5-chloro-3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(thiophen-2-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 41118424 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | (3S)-5-chloro-3-hydroxy-3-(2-oxo-2-pyridin-3-ylethyl)-1-(thiophen-2-ylmethyl)indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)N(Cc2cccs2)c2ccc(Cl)cc21)c1cccnc1 |
| InChI | InChI=1S/C20H15ClN2O3S/c21-14-5-6-17-16(9-14)20(26,10-18(24)13-3-1-7-22-11-13)19(25)23(17)12-15-4-2-8-27-15/h1-9,11,26H,10,12H2/t20-/m0/s1 |
| InChIKey | HELCZXOPRMENJP-FQEVSTJZSA-N |
| XLogP | 3.80 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |