C26H28FN3O3S — CID 41119753
(2R)-N-benzhydryl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 41119753) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is (2R)-N-benzhydryl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2R)-N-benzhydryl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 41119753 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (2R)-N-benzhydryl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC(c1ccccc1)c1ccccc1)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H28FN3O3S/c1-20(26(31)28-25(21-10-4-2-5-11-21)22-12-6-3-7-13-22)29-16-18-30(19-17-29)34(32,33)24-15-9-8-14-23(24)27/h2-15,20,25H,16-19H2,1H3,(H,28,31)/t20-/m1/s1 |
| InChIKey | APICAHDJOPPMHP-HXUWFJFHSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |