C16H27NO — CID 4112017
N-(1-adamantylmethyl)-2,2-dimethylpropanamide (PubChem CID 4112017) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,2-dimethylpropanamide.
| Compound Name | N-(1-adamantylmethyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4112017 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-(1-adamantylmethyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H27NO/c1-15(2,3)14(18)17-10-16-7-11-4-12(8-16)6-13(5-11)9-16/h11-13H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | BCSXBYINRXFTCG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |