C30H26N2O6 — CID 4112044
[2-methoxy-4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 4112044) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is [2-methoxy-4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 4112044 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | [2-methoxy-4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C=NNC(=O)COc2ccc(OCc3ccccc3)cc2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H26N2O6/c1-35-28-18-23(12-17-27(28)38-30(34)24-10-6-3-7-11-24)19-31-32-29(33)21-37-26-15-13-25(14-16-26)36-20-22-8-4-2-5-9-22/h2-19H,20-21H2,1H3,(H,32,33) |
| InChIKey | SXALTYXQAOHNFQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|